C26H21NO7 — CID 70651777
3-[4-[2-carboxy-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]ethyl]phenyl]benzoic acid (PubChem CID 70651777) has the molecular formula C26H21NO7 and a molecular weight of 459.45 g/mol. Its IUPAC name is 3-[4-[2-carboxy-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]ethyl]phenyl]benzoic acid.
| Compound Name | 3-[4-[2-carboxy-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]ethyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 70651777 |
| Molecular Formula | C26H21NO7 |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 3-[4-[2-carboxy-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]ethyl]phenyl]benzoic acid |
| SMILES | COc1ccc2oc(C(=O)NC(Cc3ccc(-c4cccc(C(=O)O)c4)cc3)C(=O)O)cc2c1 |
| InChI | InChI=1S/C26H21NO7/c1-33-20-9-10-22-19(13-20)14-23(34-22)24(28)27-21(26(31)32)11-15-5-7-16(8-6-15)17-3-2-4-18(12-17)25(29)30/h2-10,12-14,21H,11H2,1H3,(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | QIGDWWQVPJFFDI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |