C24H20N2O5 — CID 70651710
2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]-3-(4-pyridin-4-ylphenyl)propanoic acid (PubChem CID 70651710) has the molecular formula C24H20N2O5 and a molecular weight of 416.43 g/mol. Its IUPAC name is 2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]-3-(4-pyridin-4-ylphenyl)propanoic acid.
| Compound Name | 2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]-3-(4-pyridin-4-ylphenyl)propanoic acid |
|---|---|
| PubChem CID | 70651710 |
| Molecular Formula | C24H20N2O5 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]-3-(4-pyridin-4-ylphenyl)propanoic acid |
| SMILES | COc1ccc2oc(C(=O)NC(Cc3ccc(-c4ccncc4)cc3)C(=O)O)cc2c1 |
| InChI | InChI=1S/C24H20N2O5/c1-30-19-6-7-21-18(13-19)14-22(31-21)23(27)26-20(24(28)29)12-15-2-4-16(5-3-15)17-8-10-25-11-9-17/h2-11,13-14,20H,12H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | BFXXGTFUGMDXDS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |