C22H23NO6 — CID 70652439
3-[(4-ethylphenyl)methoxy]-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]propanoic acid (PubChem CID 70652439) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is 3-[(4-ethylphenyl)methoxy]-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]propanoic acid.
| Compound Name | 3-[(4-ethylphenyl)methoxy]-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 70652439 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 3-[(4-ethylphenyl)methoxy]-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]propanoic acid |
| SMILES | CCc1ccc(COCC(NC(=O)c2cc3cc(OC)ccc3o2)C(=O)O)cc1 |
| InChI | InChI=1S/C22H23NO6/c1-3-14-4-6-15(7-5-14)12-28-13-18(22(25)26)23-21(24)20-11-16-10-17(27-2)8-9-19(16)29-20/h4-11,18H,3,12-13H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | YPFFKMBIMSOYRI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |