C21H18N2O6 — CID 70651997
3-[(3-cyanophenyl)methoxy]-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]propanoic acid (PubChem CID 70651997) has the molecular formula C21H18N2O6 and a molecular weight of 394.38 g/mol. Its IUPAC name is 3-[(3-cyanophenyl)methoxy]-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]propanoic acid.
| Compound Name | 3-[(3-cyanophenyl)methoxy]-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 70651997 |
| Molecular Formula | C21H18N2O6 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 3-[(3-cyanophenyl)methoxy]-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]propanoic acid |
| SMILES | COc1ccc2oc(C(=O)NC(COCc3cccc(C#N)c3)C(=O)O)cc2c1 |
| InChI | InChI=1S/C21H18N2O6/c1-27-16-5-6-18-15(8-16)9-19(29-18)20(24)23-17(21(25)26)12-28-11-14-4-2-3-13(7-14)10-22/h2-9,17H,11-12H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | LANBWLHFBYDLEI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 121.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |