C20H18FNO6 — CID 70651258
3-[(4-fluorophenyl)methoxy]-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]propanoic acid (PubChem CID 70651258) has the molecular formula C20H18FNO6 and a molecular weight of 387.36 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methoxy]-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]propanoic acid.
| Compound Name | 3-[(4-fluorophenyl)methoxy]-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 70651258 |
| Molecular Formula | C20H18FNO6 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 3-[(4-fluorophenyl)methoxy]-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]propanoic acid |
| SMILES | COc1ccc2oc(C(=O)NC(COCc3ccc(F)cc3)C(=O)O)cc2c1 |
| InChI | InChI=1S/C20H18FNO6/c1-26-15-6-7-17-13(8-15)9-18(28-17)19(23)22-16(20(24)25)11-27-10-12-2-4-14(21)5-3-12/h2-9,16H,10-11H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | LKYRUJVSHUBTQJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |