C26H20N2O5 — CID 70651715
3-[4-(4-cyanophenyl)phenyl]-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]propanoic acid (PubChem CID 70651715) has the molecular formula C26H20N2O5 and a molecular weight of 440.46 g/mol. Its IUPAC name is 3-[4-(4-cyanophenyl)phenyl]-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]propanoic acid.
| Compound Name | 3-[4-(4-cyanophenyl)phenyl]-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 70651715 |
| Molecular Formula | C26H20N2O5 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 3-[4-(4-cyanophenyl)phenyl]-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]propanoic acid |
| SMILES | COc1ccc2oc(C(=O)NC(Cc3ccc(-c4ccc(C#N)cc4)cc3)C(=O)O)cc2c1 |
| InChI | InChI=1S/C26H20N2O5/c1-32-21-10-11-23-20(13-21)14-24(33-23)25(29)28-22(26(30)31)12-16-2-6-18(7-3-16)19-8-4-17(15-27)5-9-19/h2-11,13-14,22H,12H2,1H3,(H,28,29)(H,30,31) |
| InChIKey | LRQNQLGFIVNDLN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 112.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |