C25H24N2O6 — CID 88875517
3-[4-[(2E)-4-carbamoylpenta-2,4-dien-2-yl]phenyl]-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]propanoic acid (PubChem CID 88875517) has the molecular formula C25H24N2O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is 3-[4-[(2E)-4-carbamoylpenta-2,4-dien-2-yl]phenyl]-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]propanoic acid.
| Compound Name | 3-[4-[(2E)-4-carbamoylpenta-2,4-dien-2-yl]phenyl]-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 88875517 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 3-[4-[(2E)-4-carbamoylpenta-2,4-dien-2-yl]phenyl]-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]propanoic acid |
| SMILES | C=C(/C=C(\C)c1ccc(CC(NC(=O)c2cc3cc(OC)ccc3o2)C(=O)O)cc1)C(N)=O |
| InChI | InChI=1S/C25H24N2O6/c1-14(10-15(2)23(26)28)17-6-4-16(5-7-17)11-20(25(30)31)27-24(29)22-13-18-12-19(32-3)8-9-21(18)33-22/h4-10,12-13,20H,2,11H2,1,3H3,(H2,26,28)(H,27,29)(H,30,31)/b14-10+ |
| InChIKey | PNYDHHNWFVUYIF-GXDHUFHOSA-N |
| XLogP | 3.31 |
| TPSA | 131.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|