C27H25NO6 — CID 56597078
3-[4-(2-ethoxyphenyl)phenyl]-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]propanoic acid (PubChem CID 56597078) has the molecular formula C27H25NO6 and a molecular weight of 459.50 g/mol. Its IUPAC name is 3-[4-(2-ethoxyphenyl)phenyl]-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]propanoic acid.
| Compound Name | 3-[4-(2-ethoxyphenyl)phenyl]-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 56597078 |
| Molecular Formula | C27H25NO6 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 3-[4-(2-ethoxyphenyl)phenyl]-2-[(5-methoxy-1-benzofuran-2-carbonyl)amino]propanoic acid |
| SMILES | CCOc1ccccc1-c1ccc(CC(NC(=O)c2cc3cc(OC)ccc3o2)C(=O)O)cc1 |
| InChI | InChI=1S/C27H25NO6/c1-3-33-24-7-5-4-6-21(24)18-10-8-17(9-11-18)14-22(27(30)31)28-26(29)25-16-19-15-20(32-2)12-13-23(19)34-25/h4-13,15-16,22H,3,14H2,1-2H3,(H,28,29)(H,30,31) |
| InChIKey | AEBKBQWHZWKTSX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |