C20H16N2O5 — CID 56596693
2-[(5-cyano-1-benzofuran-2-carbonyl)amino]-3-phenylmethoxypropanoic acid (PubChem CID 56596693) has the molecular formula C20H16N2O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is 2-[(5-cyano-1-benzofuran-2-carbonyl)amino]-3-phenylmethoxypropanoic acid.
| Compound Name | 2-[(5-cyano-1-benzofuran-2-carbonyl)amino]-3-phenylmethoxypropanoic acid |
|---|---|
| PubChem CID | 56596693 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-[(5-cyano-1-benzofuran-2-carbonyl)amino]-3-phenylmethoxypropanoic acid |
| SMILES | N#Cc1ccc2oc(C(=O)NC(COCc3ccccc3)C(=O)O)cc2c1 |
| InChI | InChI=1S/C20H16N2O5/c21-10-14-6-7-17-15(8-14)9-18(27-17)19(23)22-16(20(24)25)12-26-11-13-4-2-1-3-5-13/h1-9,16H,11-12H2,(H,22,23)(H,24,25) |
| InChIKey | UUWISGGGTCLCGK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 112.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |