C21H19NO6 — CID 56596844
2-[[4-(2-hydroxyphenyl)furan-2-carbonyl]amino]-3-phenylmethoxypropanoic acid (PubChem CID 56596844) has the molecular formula C21H19NO6 and a molecular weight of 381.38 g/mol. Its IUPAC name is 2-[[4-(2-hydroxyphenyl)furan-2-carbonyl]amino]-3-phenylmethoxypropanoic acid.
| Compound Name | 2-[[4-(2-hydroxyphenyl)furan-2-carbonyl]amino]-3-phenylmethoxypropanoic acid |
|---|---|
| PubChem CID | 56596844 |
| Molecular Formula | C21H19NO6 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 2-[[4-(2-hydroxyphenyl)furan-2-carbonyl]amino]-3-phenylmethoxypropanoic acid |
| SMILES | O=C(NC(COCc1ccccc1)C(=O)O)c1cc(-c2ccccc2O)co1 |
| InChI | InChI=1S/C21H19NO6/c23-18-9-5-4-8-16(18)15-10-19(28-12-15)20(24)22-17(21(25)26)13-27-11-14-6-2-1-3-7-14/h1-10,12,17,23H,11,13H2,(H,22,24)(H,25,26) |
| InChIKey | ONNFZZYGYUQJJT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |