C13H16BrNO4 — CID 141127685
(2S)-2-(2-bromopropanoylamino)-3-phenylmethoxypropanoic acid (PubChem CID 141127685) has the molecular formula C13H16BrNO4 and a molecular weight of 330.18 g/mol. Its IUPAC name is (2S)-2-(2-bromopropanoylamino)-3-phenylmethoxypropanoic acid.
| Compound Name | (2S)-2-(2-bromopropanoylamino)-3-phenylmethoxypropanoic acid |
|---|---|
| PubChem CID | 141127685 |
| Molecular Formula | C13H16BrNO4 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | (2S)-2-(2-bromopropanoylamino)-3-phenylmethoxypropanoic acid |
| SMILES | CC(Br)C(=O)N[C@@H](COCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H16BrNO4/c1-9(14)12(16)15-11(13(17)18)8-19-7-10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3,(H,15,16)(H,17,18)/t9?,11-/m0/s1 |
| InChIKey | RFVOBBHGFSLKHE-UMJHXOGRSA-N |
| XLogP | 1.56 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|