C16H20BrNO5 — CID 141279539
2-(2-bromopropanoylamino)-6-oxo-6-phenylmethoxyhexanoic acid (PubChem CID 141279539) has the molecular formula C16H20BrNO5 and a molecular weight of 386.24 g/mol. Its IUPAC name is 2-(2-bromopropanoylamino)-6-oxo-6-phenylmethoxyhexanoic acid.
| Compound Name | 2-(2-bromopropanoylamino)-6-oxo-6-phenylmethoxyhexanoic acid |
|---|---|
| PubChem CID | 141279539 |
| Molecular Formula | C16H20BrNO5 |
| Molecular Weight | 386.24 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 2-(2-bromopropanoylamino)-6-oxo-6-phenylmethoxyhexanoic acid |
| SMILES | CC(Br)C(=O)NC(CCCC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H20BrNO5/c1-11(17)15(20)18-13(16(21)22)8-5-9-14(19)23-10-12-6-3-2-4-7-12/h2-4,6-7,11,13H,5,8-10H2,1H3,(H,18,20)(H,21,22) |
| InChIKey | XMRDKTLBQHMPMV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|