C22H23NO6 — CID 123212371
N-(1,1-dihydroxy-3-phenylmethoxypropan-2-yl)-4-(3-methoxyphenyl)furan-2-carboxamide (PubChem CID 123212371) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-(1,1-dihydroxy-3-phenylmethoxypropan-2-yl)-4-(3-methoxyphenyl)furan-2-carboxamide.
| Compound Name | N-(1,1-dihydroxy-3-phenylmethoxypropan-2-yl)-4-(3-methoxyphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 123212371 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-(1,1-dihydroxy-3-phenylmethoxypropan-2-yl)-4-(3-methoxyphenyl)furan-2-carboxamide |
| SMILES | COc1cccc(-c2coc(C(=O)NC(COCc3ccccc3)C(O)O)c2)c1 |
| InChI | InChI=1S/C22H23NO6/c1-27-18-9-5-8-16(10-18)17-11-20(29-13-17)21(24)23-19(22(25)26)14-28-12-15-6-3-2-4-7-15/h2-11,13,19,22,25-26H,12,14H2,1H3,(H,23,24) |
| InChIKey | OMILELBLLJRZGO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|