C20H18N2O5 — CID 70652014
(2S)-3-phenylmethoxy-2-[(4-pyridin-3-ylfuran-2-carbonyl)amino]propanoic acid (PubChem CID 70652014) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is (2S)-3-phenylmethoxy-2-[(4-pyridin-3-ylfuran-2-carbonyl)amino]propanoic acid.
| Compound Name | (2S)-3-phenylmethoxy-2-[(4-pyridin-3-ylfuran-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 70652014 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (2S)-3-phenylmethoxy-2-[(4-pyridin-3-ylfuran-2-carbonyl)amino]propanoic acid |
| SMILES | O=C(N[C@@H](COCc1ccccc1)C(=O)O)c1cc(-c2cccnc2)co1 |
| InChI | InChI=1S/C20H18N2O5/c23-19(18-9-16(12-27-18)15-7-4-8-21-10-15)22-17(20(24)25)13-26-11-14-5-2-1-3-6-14/h1-10,12,17H,11,13H2,(H,22,23)(H,24,25)/t17-/m0/s1 |
| InChIKey | ZHERPWPYRSQASN-KRWDZBQOSA-N |
| XLogP | 2.74 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |