C24H20ClNO6 — CID 174412836
4-[[(1S)-1-carboxy-2-[4-(3-methoxyphenyl)phenyl]ethyl]carbamoyl]-3-chlorobenzoic acid (PubChem CID 174412836) has the molecular formula C24H20ClNO6 and a molecular weight of 453.88 g/mol. Its IUPAC name is 4-[[(1S)-1-carboxy-2-[4-(3-methoxyphenyl)phenyl]ethyl]carbamoyl]-3-chlorobenzoic acid.
| Compound Name | 4-[[(1S)-1-carboxy-2-[4-(3-methoxyphenyl)phenyl]ethyl]carbamoyl]-3-chlorobenzoic acid |
|---|---|
| PubChem CID | 174412836 |
| Molecular Formula | C24H20ClNO6 |
| Molecular Weight | 453.88 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 4-[[(1S)-1-carboxy-2-[4-(3-methoxyphenyl)phenyl]ethyl]carbamoyl]-3-chlorobenzoic acid |
| SMILES | COc1cccc(-c2ccc(C[C@H](NC(=O)c3ccc(C(=O)O)cc3Cl)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C24H20ClNO6/c1-32-18-4-2-3-16(12-18)15-7-5-14(6-8-15)11-21(24(30)31)26-22(27)19-10-9-17(23(28)29)13-20(19)25/h2-10,12-13,21H,11H2,1H3,(H,26,27)(H,28,29)(H,30,31)/t21-/m0/s1 |
| InChIKey | TUSQSARXTAKPAY-NRFANRHFSA-N |
| XLogP | 4.14 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.88 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |