C21H23F3N2O2 — CID 51968871
(2R)-3-methyl-2-[(2-phenylacetyl)amino]-N-[[3-(trifluoromethyl)phenyl]methyl]butanamide (PubChem CID 51968871) has the molecular formula C21H23F3N2O2 and a molecular weight of 392.42 g/mol. Its IUPAC name is (2R)-3-methyl-2-[(2-phenylacetyl)amino]-N-[[3-(trifluoromethyl)phenyl]methyl]butanamide.
| Compound Name | (2R)-3-methyl-2-[(2-phenylacetyl)amino]-N-[[3-(trifluoromethyl)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 51968871 |
| Molecular Formula | C21H23F3N2O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (2R)-3-methyl-2-[(2-phenylacetyl)amino]-N-[[3-(trifluoromethyl)phenyl]methyl]butanamide |
| SMILES | CC(C)[C@@H](NC(=O)Cc1ccccc1)C(=O)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H23F3N2O2/c1-14(2)19(26-18(27)12-15-7-4-3-5-8-15)20(28)25-13-16-9-6-10-17(11-16)21(22,23)24/h3-11,14,19H,12-13H2,1-2H3,(H,25,28)(H,26,27)/t19-/m1/s1 |
| InChIKey | HQTXLRHTVQEJCV-LJQANCHMSA-N |
| XLogP | 3.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |