C18H18F3NO3 — CID 100704874
(2S)-2-(3-methoxyphenoxy)-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide (PubChem CID 100704874) has the molecular formula C18H18F3NO3 and a molecular weight of 353.34 g/mol. Its IUPAC name is (2S)-2-(3-methoxyphenoxy)-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide.
| Compound Name | (2S)-2-(3-methoxyphenoxy)-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 100704874 |
| Molecular Formula | C18H18F3NO3 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | (2S)-2-(3-methoxyphenoxy)-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide |
| SMILES | COc1cccc(O[C@@H](C)C(=O)NCc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C18H18F3NO3/c1-12(25-16-8-4-7-15(10-16)24-2)17(23)22-11-13-5-3-6-14(9-13)18(19,20)21/h3-10,12H,11H2,1-2H3,(H,22,23)/t12-/m0/s1 |
| InChIKey | SIFHXHRTUALPBP-LBPRGKRZSA-N |
| XLogP | 3.80 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |