C17H15ClF3NO2 — CID 43001904
2-(3-chlorophenoxy)-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide (PubChem CID 43001904) has the molecular formula C17H15ClF3NO2 and a molecular weight of 357.76 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide.
| Compound Name | 2-(3-chlorophenoxy)-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 43001904 |
| Molecular Formula | C17H15ClF3NO2 |
| Molecular Weight | 357.76 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide |
| SMILES | CC(Oc1cccc(Cl)c1)C(=O)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15ClF3NO2/c1-11(24-15-7-3-6-14(18)9-15)16(23)22-10-12-4-2-5-13(8-12)17(19,20)21/h2-9,11H,10H2,1H3,(H,22,23) |
| InChIKey | DDKXHJKNXQJUBJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.76 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |