C19H22ClNO5 — CID 41261490
(2R)-2-(3-chlorophenoxy)-N-[(3,4,5-trimethoxyphenyl)methyl]propanamide (PubChem CID 41261490) has the molecular formula C19H22ClNO5 and a molecular weight of 379.84 g/mol. Its IUPAC name is (2R)-2-(3-chlorophenoxy)-N-[(3,4,5-trimethoxyphenyl)methyl]propanamide.
| Compound Name | (2R)-2-(3-chlorophenoxy)-N-[(3,4,5-trimethoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 41261490 |
| Molecular Formula | C19H22ClNO5 |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (2R)-2-(3-chlorophenoxy)-N-[(3,4,5-trimethoxyphenyl)methyl]propanamide |
| SMILES | COc1cc(CNC(=O)[C@@H](C)Oc2cccc(Cl)c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H22ClNO5/c1-12(26-15-7-5-6-14(20)10-15)19(22)21-11-13-8-16(23-2)18(25-4)17(9-13)24-3/h5-10,12H,11H2,1-4H3,(H,21,22)/t12-/m1/s1 |
| InChIKey | MLOQYLSBOILIQY-GFCCVEGCSA-N |
| XLogP | 3.45 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |