C19H22ClNO4 — CID 7026894
(2S)-2-(3-chlorophenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide (PubChem CID 7026894) has the molecular formula C19H22ClNO4 and a molecular weight of 363.84 g/mol. Its IUPAC name is (2S)-2-(3-chlorophenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide.
| Compound Name | (2S)-2-(3-chlorophenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 7026894 |
| Molecular Formula | C19H22ClNO4 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | (2S)-2-(3-chlorophenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide |
| SMILES | COc1ccc(CCNC(=O)[C@H](C)Oc2cccc(Cl)c2)cc1OC |
| InChI | InChI=1S/C19H22ClNO4/c1-13(25-16-6-4-5-15(20)12-16)19(22)21-10-9-14-7-8-17(23-2)18(11-14)24-3/h4-8,11-13H,9-10H2,1-3H3,(H,21,22)/t13-/m0/s1 |
| InChIKey | UIYQHHIIHODZID-ZDUSSCGKSA-N |
| XLogP | 3.48 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |