C23H31NO4 — CID 8624083
(2R)-2-(4-tert-butylphenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide (PubChem CID 8624083) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is (2R)-2-(4-tert-butylphenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide.
| Compound Name | (2R)-2-(4-tert-butylphenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 8624083 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | (2R)-2-(4-tert-butylphenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide |
| SMILES | COc1ccc(CCNC(=O)[C@@H](C)Oc2ccc(C(C)(C)C)cc2)cc1OC |
| InChI | InChI=1S/C23H31NO4/c1-16(28-19-10-8-18(9-11-19)23(2,3)4)22(25)24-14-13-17-7-12-20(26-5)21(15-17)27-6/h7-12,15-16H,13-14H2,1-6H3,(H,24,25)/t16-/m1/s1 |
| InChIKey | ZXEFSAYMHYJOPW-MRXNPFEDSA-N |
| XLogP | 4.13 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |