C19H21Cl2NO4 — CID 2164093
(2R)-2-(2,4-dichlorophenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide (PubChem CID 2164093) has the molecular formula C19H21Cl2NO4 and a molecular weight of 398.29 g/mol. Its IUPAC name is (2R)-2-(2,4-dichlorophenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide.
| Compound Name | (2R)-2-(2,4-dichlorophenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 2164093 |
| Molecular Formula | C19H21Cl2NO4 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | (2R)-2-(2,4-dichlorophenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide |
| SMILES | COc1ccc(CCNC(=O)[C@@H](C)Oc2ccc(Cl)cc2Cl)cc1OC |
| InChI | InChI=1S/C19H21Cl2NO4/c1-12(26-16-7-5-14(20)11-15(16)21)19(23)22-9-8-13-4-6-17(24-2)18(10-13)25-3/h4-7,10-12H,8-9H2,1-3H3,(H,22,23)/t12-/m1/s1 |
| InChIKey | WXQBVZQSVDOUML-GFCCVEGCSA-N |
| XLogP | 4.14 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |