C20H20F3NO4 — CID 67361234
3-[[2-(3-methoxyphenyl)acetyl]amino]-4-[3-(trifluoromethyl)phenyl]butanoic acid (PubChem CID 67361234) has the molecular formula C20H20F3NO4 and a molecular weight of 395.38 g/mol. Its IUPAC name is 3-[[2-(3-methoxyphenyl)acetyl]amino]-4-[3-(trifluoromethyl)phenyl]butanoic acid.
| Compound Name | 3-[[2-(3-methoxyphenyl)acetyl]amino]-4-[3-(trifluoromethyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 67361234 |
| Molecular Formula | C20H20F3NO4 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 3-[[2-(3-methoxyphenyl)acetyl]amino]-4-[3-(trifluoromethyl)phenyl]butanoic acid |
| SMILES | COc1cccc(CC(=O)NC(CC(=O)O)Cc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C20H20F3NO4/c1-28-17-7-3-5-14(10-17)11-18(25)24-16(12-19(26)27)9-13-4-2-6-15(8-13)20(21,22)23/h2-8,10,16H,9,11-12H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | BOYMNDZPMSGGOB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |