C19H20F3NO6 — CID 17367770
N-[(3,5-dimethoxyphenyl)methyl]-1-[3-(trifluoromethyl)phenyl]methanamine;oxalic acid (PubChem CID 17367770) has the molecular formula C19H20F3NO6 and a molecular weight of 415.36 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methyl]-1-[3-(trifluoromethyl)phenyl]methanamine;oxalic acid.
| Compound Name | N-[(3,5-dimethoxyphenyl)methyl]-1-[3-(trifluoromethyl)phenyl]methanamine;oxalic acid |
|---|---|
| PubChem CID | 17367770 |
| Molecular Formula | C19H20F3NO6 |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methyl]-1-[3-(trifluoromethyl)phenyl]methanamine;oxalic acid |
| SMILES | COc1cc(CNCc2cccc(C(F)(F)F)c2)cc(OC)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H18F3NO2.C2H2O4/c1-22-15-7-13(8-16(9-15)23-2)11-21-10-12-4-3-5-14(6-12)17(18,19)20;3-1(4)2(5)6/h3-9,21H,10-11H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | WEOMOSSFQPIWPS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|