C16H13F6NO — CID 55464693
1-[4-(trifluoromethoxy)phenyl]-N-[[3-(trifluoromethyl)phenyl]methyl]methanamine (PubChem CID 55464693) has the molecular formula C16H13F6NO and a molecular weight of 349.27 g/mol. Its IUPAC name is 1-[4-(trifluoromethoxy)phenyl]-N-[[3-(trifluoromethyl)phenyl]methyl]methanamine.
| Compound Name | 1-[4-(trifluoromethoxy)phenyl]-N-[[3-(trifluoromethyl)phenyl]methyl]methanamine |
|---|---|
| PubChem CID | 55464693 |
| Molecular Formula | C16H13F6NO |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 1-[4-(trifluoromethoxy)phenyl]-N-[[3-(trifluoromethyl)phenyl]methyl]methanamine |
| SMILES | FC(F)(F)Oc1ccc(CNCc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C16H13F6NO/c17-15(18,19)13-3-1-2-12(8-13)10-23-9-11-4-6-14(7-5-11)24-16(20,21)22/h1-8,23H,9-10H2 |
| InChIKey | MBQHLRDCKPAODN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |