C16H15BrF3N — CID 105400992
N-[(3-bromo-4-methylphenyl)methyl]-1-[3-(trifluoromethyl)phenyl]methanamine (PubChem CID 105400992) has the molecular formula C16H15BrF3N and a molecular weight of 358.20 g/mol. Its IUPAC name is N-[(3-bromo-4-methylphenyl)methyl]-1-[3-(trifluoromethyl)phenyl]methanamine.
| Compound Name | N-[(3-bromo-4-methylphenyl)methyl]-1-[3-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 105400992 |
| Molecular Formula | C16H15BrF3N |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | N-[(3-bromo-4-methylphenyl)methyl]-1-[3-(trifluoromethyl)phenyl]methanamine |
| SMILES | Cc1ccc(CNCc2cccc(C(F)(F)F)c2)cc1Br |
| InChI | InChI=1S/C16H15BrF3N/c1-11-5-6-13(8-15(11)17)10-21-9-12-3-2-4-14(7-12)16(18,19)20/h2-8,21H,9-10H2,1H3 |
| InChIKey | YCDPWKHIQGMEIL-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |