C13H17BrF3N — CID 113344570
N-[(3-bromo-4-methylphenyl)methyl]-5,5,5-trifluoropentan-1-amine (PubChem CID 113344570) has the molecular formula C13H17BrF3N and a molecular weight of 324.18 g/mol. Its IUPAC name is N-[(3-bromo-4-methylphenyl)methyl]-5,5,5-trifluoropentan-1-amine.
| Compound Name | N-[(3-bromo-4-methylphenyl)methyl]-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 113344570 |
| Molecular Formula | C13H17BrF3N |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | N-[(3-bromo-4-methylphenyl)methyl]-5,5,5-trifluoropentan-1-amine |
| SMILES | Cc1ccc(CNCCCCC(F)(F)F)cc1Br |
| InChI | InChI=1S/C13H17BrF3N/c1-10-4-5-11(8-12(10)14)9-18-7-3-2-6-13(15,16)17/h4-5,8,18H,2-3,6-7,9H2,1H3 |
| InChIKey | NEVNJMXDTYVPLN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|