C14H22BrN — CID 105401081
N-[(3-bromo-4-methylphenyl)methyl]hexan-1-amine (PubChem CID 105401081) has the molecular formula C14H22BrN and a molecular weight of 284.24 g/mol. Its IUPAC name is N-[(3-bromo-4-methylphenyl)methyl]hexan-1-amine.
| Compound Name | N-[(3-bromo-4-methylphenyl)methyl]hexan-1-amine |
|---|---|
| PubChem CID | 105401081 |
| Molecular Formula | C14H22BrN |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | N-[(3-bromo-4-methylphenyl)methyl]hexan-1-amine |
| SMILES | CCCCCCNCc1ccc(C)c(Br)c1 |
| InChI | InChI=1S/C14H22BrN/c1-3-4-5-6-9-16-11-13-8-7-12(2)14(15)10-13/h7-8,10,16H,3-6,9,11H2,1-2H3 |
| InChIKey | JCUFNGUJZSNEOI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|