C19H24BrNO — CID 17157671
N-[(3-bromo-4-phenylmethoxyphenyl)methyl]pentan-1-amine (PubChem CID 17157671) has the molecular formula C19H24BrNO and a molecular weight of 362.31 g/mol. Its IUPAC name is N-[(3-bromo-4-phenylmethoxyphenyl)methyl]pentan-1-amine.
| Compound Name | N-[(3-bromo-4-phenylmethoxyphenyl)methyl]pentan-1-amine |
|---|---|
| PubChem CID | 17157671 |
| Molecular Formula | C19H24BrNO |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N-[(3-bromo-4-phenylmethoxyphenyl)methyl]pentan-1-amine |
| SMILES | CCCCCNCc1ccc(OCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C19H24BrNO/c1-2-3-7-12-21-14-17-10-11-19(18(20)13-17)22-15-16-8-5-4-6-9-16/h4-6,8-11,13,21H,2-3,7,12,14-15H2,1H3 |
| InChIKey | JJQCBRDEMXSNTK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|