C19H27BrCl2N2O — CID 17215801
N'-[(3-bromo-4-phenylmethoxyphenyl)methyl]-N-ethylpropane-1,3-diamine;dihydrochloride (PubChem CID 17215801) has the molecular formula C19H27BrCl2N2O and a molecular weight of 450.25 g/mol. Its IUPAC name is N'-[(3-bromo-4-phenylmethoxyphenyl)methyl]-N-ethylpropane-1,3-diamine;dihydrochloride.
| Compound Name | N'-[(3-bromo-4-phenylmethoxyphenyl)methyl]-N-ethylpropane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17215801 |
| Molecular Formula | C19H27BrCl2N2O |
| Molecular Weight | 450.25 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | N'-[(3-bromo-4-phenylmethoxyphenyl)methyl]-N-ethylpropane-1,3-diamine;dihydrochloride |
| SMILES | CCNCCCNCc1ccc(OCc2ccccc2)c(Br)c1.Cl.Cl |
| InChI | InChI=1S/C19H25BrN2O.2ClH/c1-2-21-11-6-12-22-14-17-9-10-19(18(20)13-17)23-15-16-7-4-3-5-8-16;;/h3-5,7-10,13,21-22H,2,6,11-12,14-15H2,1H3;2*1H |
| InChIKey | OOSGKEYEPOOKTC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.25 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|