C19H24Br2N2O — CID 17215806
N'-[(3,5-dibromo-4-phenylmethoxyphenyl)methyl]-N-ethylpropane-1,3-diamine (PubChem CID 17215806) has the molecular formula C19H24Br2N2O and a molecular weight of 456.22 g/mol. Its IUPAC name is N'-[(3,5-dibromo-4-phenylmethoxyphenyl)methyl]-N-ethylpropane-1,3-diamine.
| Compound Name | N'-[(3,5-dibromo-4-phenylmethoxyphenyl)methyl]-N-ethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 17215806 |
| Molecular Formula | C19H24Br2N2O |
| Molecular Weight | 456.22 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | N'-[(3,5-dibromo-4-phenylmethoxyphenyl)methyl]-N-ethylpropane-1,3-diamine |
| SMILES | CCNCCCNCc1cc(Br)c(OCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C19H24Br2N2O/c1-2-22-9-6-10-23-13-16-11-17(20)19(18(21)12-16)24-14-15-7-4-3-5-8-15/h3-5,7-8,11-12,22-23H,2,6,9-10,13-14H2,1H3 |
| InChIKey | WQHJJTARGWFBQF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.22 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|