C20H26BrFN2O2 — CID 17215522
N'-[[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-N-ethylpropane-1,3-diamine (PubChem CID 17215522) has the molecular formula C20H26BrFN2O2 and a molecular weight of 425.34 g/mol. Its IUPAC name is N'-[[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-N-ethylpropane-1,3-diamine.
| Compound Name | N'-[[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-N-ethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 17215522 |
| Molecular Formula | C20H26BrFN2O2 |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | N'-[[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-N-ethylpropane-1,3-diamine |
| SMILES | CCNCCCNCc1cc(Br)c(OCc2ccccc2F)c(OC)c1 |
| InChI | InChI=1S/C20H26BrFN2O2/c1-3-23-9-6-10-24-13-15-11-17(21)20(19(12-15)25-2)26-14-16-7-4-5-8-18(16)22/h4-5,7-8,11-12,23-24H,3,6,9-10,13-14H2,1-2H3 |
| InChIKey | ALSTVDCPTQSSOJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|