C26H29BrFNO4 — CID 4716331
N-[[3-bromo-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine (PubChem CID 4716331) has the molecular formula C26H29BrFNO4 and a molecular weight of 518.42 g/mol. Its IUPAC name is N-[[3-bromo-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine.
| Compound Name | N-[[3-bromo-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 4716331 |
| Molecular Formula | C26H29BrFNO4 |
| Molecular Weight | 518.42 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | N-[[3-bromo-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine |
| SMILES | CCOc1cc(CNCCc2ccc(OC)c(OC)c2)cc(Br)c1OCc1ccccc1F |
| InChI | InChI=1S/C26H29BrFNO4/c1-4-32-25-15-19(13-21(27)26(25)33-17-20-7-5-6-8-22(20)28)16-29-12-11-18-9-10-23(30-2)24(14-18)31-3/h5-10,13-15,29H,4,11-12,16-17H2,1-3H3 |
| InChIKey | UXRLPFKWLRVWSM-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.42 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|