C26H29ClFNO4 — CID 66531064
N-[[2-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine (PubChem CID 66531064) has the molecular formula C26H29ClFNO4 and a molecular weight of 473.97 g/mol. Its IUPAC name is N-[[2-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine.
| Compound Name | N-[[2-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 66531064 |
| Molecular Formula | C26H29ClFNO4 |
| Molecular Weight | 473.97 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | N-[[2-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine |
| SMILES | CCOc1cc(CNCCc2ccc(OC)c(OC)c2)c(Cl)cc1OCc1ccccc1F |
| InChI | InChI=1S/C26H29ClFNO4/c1-4-32-25-14-20(16-29-12-11-18-9-10-23(30-2)24(13-18)31-3)21(27)15-26(25)33-17-19-7-5-6-8-22(19)28/h5-10,13-15,29H,4,11-12,16-17H2,1-3H3 |
| InChIKey | ZWVIXSWYJPLGFP-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.97 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|