C26H28Cl2FNO4 — CID 66531671
N-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine (PubChem CID 66531671) has the molecular formula C26H28Cl2FNO4 and a molecular weight of 508.42 g/mol. Its IUPAC name is N-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine.
| Compound Name | N-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 66531671 |
| Molecular Formula | C26H28Cl2FNO4 |
| Molecular Weight | 508.42 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | N-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine |
| SMILES | CCOc1cc(CNCCc2ccc(OC)c(OC)c2)c(Cl)cc1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C26H28Cl2FNO4/c1-4-33-25-13-18(15-30-11-10-17-8-9-23(31-2)24(12-17)32-3)21(28)14-26(25)34-16-19-20(27)6-5-7-22(19)29/h5-9,12-14,30H,4,10-11,15-16H2,1-3H3 |
| InChIKey | NMENZCHCGFSPGH-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.42 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|