C20H24Cl2FNO2 — CID 66530086
N-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-methylbutan-1-amine (PubChem CID 66530086) has the molecular formula C20H24Cl2FNO2 and a molecular weight of 400.32 g/mol. Its IUPAC name is N-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-methylbutan-1-amine.
| Compound Name | N-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 66530086 |
| Molecular Formula | C20H24Cl2FNO2 |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | N-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-methylbutan-1-amine |
| SMILES | COc1cc(CNCCC(C)C)c(Cl)cc1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C20H24Cl2FNO2/c1-13(2)7-8-24-11-14-9-19(25-3)20(10-17(14)22)26-12-15-16(21)5-4-6-18(15)23/h4-6,9-10,13,24H,7-8,11-12H2,1-3H3 |
| InChIKey | UEVCDMRVJOFIRJ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|