C21H28ClNO2 — CID 66530240
N-[[2-chloro-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]-3-methylbutan-1-amine (PubChem CID 66530240) has the molecular formula C21H28ClNO2 and a molecular weight of 361.91 g/mol. Its IUPAC name is N-[[2-chloro-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]-3-methylbutan-1-amine.
| Compound Name | N-[[2-chloro-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 66530240 |
| Molecular Formula | C21H28ClNO2 |
| Molecular Weight | 361.91 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-[[2-chloro-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]-3-methylbutan-1-amine |
| SMILES | COc1cc(CNCCC(C)C)c(Cl)cc1OCc1ccccc1C |
| InChI | InChI=1S/C21H28ClNO2/c1-15(2)9-10-23-13-18-11-20(24-4)21(12-19(18)22)25-14-17-8-6-5-7-16(17)3/h5-8,11-12,15,23H,9-10,13-14H2,1-4H3 |
| InChIKey | GRFCKTASIQEXLW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.91 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|