C21H30ClNO2 — CID 17210568
N-[[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]-3-methylbutan-1-amine;hydrochloride (PubChem CID 17210568) has the molecular formula C21H30ClNO2 and a molecular weight of 363.93 g/mol. Its IUPAC name is N-[[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]-3-methylbutan-1-amine;hydrochloride.
| Compound Name | N-[[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]-3-methylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17210568 |
| Molecular Formula | C21H30ClNO2 |
| Molecular Weight | 363.93 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | N-[[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]-3-methylbutan-1-amine;hydrochloride |
| SMILES | COc1cc(CNCCC(C)C)ccc1OCc1ccccc1C.Cl |
| InChI | InChI=1S/C21H29NO2.ClH/c1-16(2)11-12-22-14-18-9-10-20(21(13-18)23-4)24-15-19-8-6-5-7-17(19)3;/h5-10,13,16,22H,11-12,14-15H2,1-4H3;1H |
| InChIKey | OETBEMCMRWQHJK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.93 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|