C20H25Cl2FN2O3 — CID 66537743
2-[3-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]methylamino]propylamino]ethanol (PubChem CID 66537743) has the molecular formula C20H25Cl2FN2O3 and a molecular weight of 431.34 g/mol. Its IUPAC name is 2-[3-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]methylamino]propylamino]ethanol.
| Compound Name | 2-[3-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]methylamino]propylamino]ethanol |
|---|---|
| PubChem CID | 66537743 |
| Molecular Formula | C20H25Cl2FN2O3 |
| Molecular Weight | 431.34 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 2-[3-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]methylamino]propylamino]ethanol |
| SMILES | COc1cc(CNCCCNCCO)c(Cl)cc1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C20H25Cl2FN2O3/c1-27-19-10-14(12-25-7-3-6-24-8-9-26)17(22)11-20(19)28-13-15-16(21)4-2-5-18(15)23/h2,4-5,10-11,24-26H,3,6-9,12-13H2,1H3 |
| InChIKey | MGGZYJKAPJTOBS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|