C21H25Cl2FN2O3 — CID 66537734
N-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-morpholin-4-ylethanamine (PubChem CID 66537734) has the molecular formula C21H25Cl2FN2O3 and a molecular weight of 443.35 g/mol. Its IUPAC name is N-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-morpholin-4-ylethanamine.
| Compound Name | N-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 66537734 |
| Molecular Formula | C21H25Cl2FN2O3 |
| Molecular Weight | 443.35 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | N-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-morpholin-4-ylethanamine |
| SMILES | COc1cc(CNCCN2CCOCC2)c(Cl)cc1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C21H25Cl2FN2O3/c1-27-20-11-15(13-25-5-6-26-7-9-28-10-8-26)18(23)12-21(20)29-14-16-17(22)3-2-4-19(16)24/h2-4,11-12,25H,5-10,13-14H2,1H3 |
| InChIKey | RRCKBWNTHZZNOK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|