C21H16Cl4FNO3 — CID 66540222
2,6-dichloro-4-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]methylamino]phenol (PubChem CID 66540222) has the molecular formula C21H16Cl4FNO3 and a molecular weight of 491.17 g/mol. Its IUPAC name is 2,6-dichloro-4-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]methylamino]phenol.
| Compound Name | 2,6-dichloro-4-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]methylamino]phenol |
|---|---|
| PubChem CID | 66540222 |
| Molecular Formula | C21H16Cl4FNO3 |
| Molecular Weight | 491.17 g/mol |
| Exact Mass | 488.99 |
| IUPAC Name | 2,6-dichloro-4-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]methylamino]phenol |
| SMILES | COc1cc(CNc2cc(Cl)c(O)c(Cl)c2)c(Cl)cc1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C21H16Cl4FNO3/c1-29-19-5-11(9-27-12-6-16(24)21(28)17(25)7-12)15(23)8-20(19)30-10-13-14(22)3-2-4-18(13)26/h2-8,27-28H,9-10H2,1H3 |
| InChIKey | AMGXIGVEVVWZNN-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.17 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|