C22H20Cl3NO3 — CID 66540309
N-[[2-chloro-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-4-methoxyaniline (PubChem CID 66540309) has the molecular formula C22H20Cl3NO3 and a molecular weight of 452.77 g/mol. Its IUPAC name is N-[[2-chloro-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-4-methoxyaniline.
| Compound Name | N-[[2-chloro-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 66540309 |
| Molecular Formula | C22H20Cl3NO3 |
| Molecular Weight | 452.77 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | N-[[2-chloro-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-4-methoxyaniline |
| SMILES | COc1ccc(NCc2cc(OC)c(OCc3c(Cl)cccc3Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C22H20Cl3NO3/c1-27-16-8-6-15(7-9-16)26-12-14-10-21(28-2)22(11-20(14)25)29-13-17-18(23)4-3-5-19(17)24/h3-11,26H,12-13H2,1-2H3 |
| InChIKey | KPCCYNXTQUPGRQ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.77 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|