C21H18Cl3NO2 — CID 66539636
4-chloro-N-[[2-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]aniline (PubChem CID 66539636) has the molecular formula C21H18Cl3NO2 and a molecular weight of 422.74 g/mol. Its IUPAC name is 4-chloro-N-[[2-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]aniline.
| Compound Name | 4-chloro-N-[[2-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]aniline |
|---|---|
| PubChem CID | 66539636 |
| Molecular Formula | C21H18Cl3NO2 |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 4-chloro-N-[[2-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]aniline |
| SMILES | COc1cc(CNc2ccc(Cl)cc2)c(Cl)cc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18Cl3NO2/c1-26-20-10-15(12-25-18-8-6-17(23)7-9-18)19(24)11-21(20)27-13-14-2-4-16(22)5-3-14/h2-11,25H,12-13H2,1H3 |
| InChIKey | JAUVZLHXTMKWOM-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |