C21H19Cl2NO3 — CID 66540451
4-[[2-chloro-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]phenol (PubChem CID 66540451) has the molecular formula C21H19Cl2NO3 and a molecular weight of 404.29 g/mol. Its IUPAC name is 4-[[2-chloro-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]phenol.
| Compound Name | 4-[[2-chloro-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]phenol |
|---|---|
| PubChem CID | 66540451 |
| Molecular Formula | C21H19Cl2NO3 |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 4-[[2-chloro-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]phenol |
| SMILES | COc1cc(CNc2ccc(O)cc2)c(Cl)cc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H19Cl2NO3/c1-26-20-10-15(12-24-17-5-7-18(25)8-6-17)19(23)11-21(20)27-13-14-3-2-4-16(22)9-14/h2-11,24-25H,12-13H2,1H3 |
| InChIKey | UKUXPMHHQPIWAN-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_OH_alk_A(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|