C23H22BrCl2NO3 — CID 66541237
N-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-chloro-4-methoxyaniline (PubChem CID 66541237) has the molecular formula C23H22BrCl2NO3 and a molecular weight of 511.24 g/mol. Its IUPAC name is N-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-chloro-4-methoxyaniline.
| Compound Name | N-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-chloro-4-methoxyaniline |
|---|---|
| PubChem CID | 66541237 |
| Molecular Formula | C23H22BrCl2NO3 |
| Molecular Weight | 511.24 g/mol |
| Exact Mass | 509.02 |
| IUPAC Name | N-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-chloro-4-methoxyaniline |
| SMILES | CCOc1cc(CNc2ccc(OC)c(Cl)c2)c(Br)cc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H22BrCl2NO3/c1-3-29-22-10-16(13-27-18-7-8-21(28-2)20(26)11-18)19(24)12-23(22)30-14-15-5-4-6-17(25)9-15/h4-12,27H,3,13-14H2,1-2H3 |
| InChIKey | LMIQNRFQFXPCBN-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.24 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|