C22H20Br2ClNO2 — CID 66541479
4-bromo-N-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]aniline (PubChem CID 66541479) has the molecular formula C22H20Br2ClNO2 and a molecular weight of 525.67 g/mol. Its IUPAC name is 4-bromo-N-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]aniline.
| Compound Name | 4-bromo-N-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]aniline |
|---|---|
| PubChem CID | 66541479 |
| Molecular Formula | C22H20Br2ClNO2 |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 522.95 |
| IUPAC Name | 4-bromo-N-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]aniline |
| SMILES | CCOc1cc(CNc2ccc(Br)cc2)c(Br)cc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H20Br2ClNO2/c1-2-27-21-11-16(13-26-19-8-6-17(23)7-9-19)20(24)12-22(21)28-14-15-4-3-5-18(25)10-15/h3-12,26H,2,13-14H2,1H3 |
| InChIKey | LCHPGDHMVQULKM-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |