C19H21BrClNO4 — CID 66533562
2-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]propanoic acid (PubChem CID 66533562) has the molecular formula C19H21BrClNO4 and a molecular weight of 442.74 g/mol. Its IUPAC name is 2-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]propanoic acid.
| Compound Name | 2-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 66533562 |
| Molecular Formula | C19H21BrClNO4 |
| Molecular Weight | 442.74 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | 2-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]propanoic acid |
| SMILES | CCOc1cc(CNC(C)C(=O)O)c(Br)cc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H21BrClNO4/c1-3-25-17-8-14(10-22-12(2)19(23)24)16(20)9-18(17)26-11-13-5-4-6-15(21)7-13/h4-9,12,22H,3,10-11H2,1-2H3,(H,23,24) |
| InChIKey | YGPOGEFJRSGNQL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.74 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |