C25H27BrClNO3 — CID 66533485
N-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-(2-methoxyphenyl)ethanamine (PubChem CID 66533485) has the molecular formula C25H27BrClNO3 and a molecular weight of 504.85 g/mol. Its IUPAC name is N-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-(2-methoxyphenyl)ethanamine.
| Compound Name | N-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-(2-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 66533485 |
| Molecular Formula | C25H27BrClNO3 |
| Molecular Weight | 504.85 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | N-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-2-(2-methoxyphenyl)ethanamine |
| SMILES | CCOc1cc(CNCCc2ccccc2OC)c(Br)cc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C25H27BrClNO3/c1-3-30-24-14-20(16-28-12-11-19-8-4-5-10-23(19)29-2)22(26)15-25(24)31-17-18-7-6-9-21(27)13-18/h4-10,13-15,28H,3,11-12,16-17H2,1-2H3 |
| InChIKey | LLDNZWNIUUVRLH-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.85 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|