C19H23BrClNO4 — CID 66535164
2-[2-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]ethoxy]ethanol (PubChem CID 66535164) has the molecular formula C19H23BrClNO4 and a molecular weight of 444.75 g/mol. Its IUPAC name is 2-[2-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]ethoxy]ethanol.
| Compound Name | 2-[2-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]ethoxy]ethanol |
|---|---|
| PubChem CID | 66535164 |
| Molecular Formula | C19H23BrClNO4 |
| Molecular Weight | 444.75 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | 2-[2-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]ethoxy]ethanol |
| SMILES | COc1cc(CNCCOCCO)c(Br)cc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H23BrClNO4/c1-24-18-10-15(12-22-5-7-25-8-6-23)17(20)11-19(18)26-13-14-3-2-4-16(21)9-14/h2-4,9-11,22-23H,5-8,12-13H2,1H3 |
| InChIKey | DTAQMOWRXWQWPR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.75 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|