C15H24BrNO4 — CID 66533831
2-[2-[(2-bromo-4,5-diethoxyphenyl)methylamino]ethoxy]ethanol (PubChem CID 66533831) has the molecular formula C15H24BrNO4 and a molecular weight of 362.26 g/mol. Its IUPAC name is 2-[2-[(2-bromo-4,5-diethoxyphenyl)methylamino]ethoxy]ethanol.
| Compound Name | 2-[2-[(2-bromo-4,5-diethoxyphenyl)methylamino]ethoxy]ethanol |
|---|---|
| PubChem CID | 66533831 |
| Molecular Formula | C15H24BrNO4 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 2-[2-[(2-bromo-4,5-diethoxyphenyl)methylamino]ethoxy]ethanol |
| SMILES | CCOc1cc(Br)c(CNCCOCCO)cc1OCC |
| InChI | InChI=1S/C15H24BrNO4/c1-3-20-14-9-12(11-17-5-7-19-8-6-18)13(16)10-15(14)21-4-2/h9-10,17-18H,3-8,11H2,1-2H3 |
| InChIKey | YVFWQSXPCAIHFP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|